| Name | Oxalyl dihydrazide |
| Synonyms | Oxalhydrazide AURORA KA-6471 oxalohydrazide Oxalic hydrazide ethanedihydrazide Oxalic dihydrazide Oxalyl dihydrazide Oxalic acid hydrazide Ethanedioyl dihydrazide Oxalic acid dihydrazone Oxalic acid bishydrazide ethanedioicacid,dihydrazide |
| CAS | 996-98-5 |
| EINECS | 213-640-2 |
| InChI | InChI=1/C2H6N4O2/c3-5-1(7)2(8)6-4/h3-4H2,(H,5,7)(H,6,8) |
| Molecular Formula | C2H6N4O2 |
| Molar Mass | 118.1 |
| Density | 1.4580 |
| Melting Point | 242-244°C (dec.)(lit.) |
| Boling Point | 220.6°C (rough estimate) |
| Water Solubility | almost transparency in hot Water |
| Appearance | white to yellowish solid |
| Color | White to off white |
| Odor | Odorless |
| BRN | 1072110 |
| pKa | 10.61±0.20(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.4462 (estimate) |
| MDL | MFCD00007608 |
| Physical and Chemical Properties | Melting point 239-243°C |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36 - Wear suitable protective clothing. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | RO2840000 |
| TSCA | Yes |
| HS Code | 29280090 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |